2,4-Dichloro-5-(trifluoromethyl)quinazoline - CAS 134517-56-9
Catalog: |
BB007947 |
Product Name: |
2,4-Dichloro-5-(trifluoromethyl)quinazoline |
CAS: |
134517-56-9 |
Synonyms: |
2,4-dichloro-5-(trifluoromethyl)quinazoline; 2,4-dichloro-5-(trifluoromethyl)quinazoline |
IUPAC Name: | 2,4-dichloro-5-(trifluoromethyl)quinazoline |
Description: | 2,4-Dichloro-5-(trifluoromethyl)quinazoline (CAS# 134517-56-9) is a useful research chemical compound. |
Molecular Weight: | 267.032 |
Molecular Formula: | C9H3Cl2F3N2 |
Canonical SMILES: | C1=CC(=C2C(=C1)N=C(N=C2Cl)Cl)C(F)(F)F |
InChI: | InChI=1S/C9H3Cl2F3N2/c10-7-6-4(9(12,13)14)2-1-3-5(6)15-8(11)16-7/h1-3H |
InChI Key: | MGMZEWORTYBDQY-UHFFFAOYSA-N |
Storage: | Inert atmosphere, 2-8 °C |
LogP: | 3.95540 |
Publication Number | Title | Priority Date |
AU-2009203124-A1 | Quinazolines and related heterocyclic compounds, and their therapeutic use | 20080102 |
AU-2009203124-B2 | Quinazolines and related heterocyclic compounds, and their therapeutic use | 20080102 |
CA-2711272-A1 | Quinazolines and related heterocyclic compounds, and their therapeutic use | 20080102 |
EP-2077263-A1 | Quinazolines and related heterocyclic compounds and their therapeutic use | 20080102 |
EP-2238119-A1 | Quinazolines and related heterocyclic compounds, and their therapeutic use | 20080102 |
Complexity: | 262 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 265.962538 |
Formal Charge: | 0 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 265.962538 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 25.8 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 4.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Quinazolines
Customers Also Viewed
-
[79551-14-7]
Ferene Disodium Salt
-
[132182-92-4]
Pentane, 1,1,1,2,2,3,4,5,5,5-decafluoro-3-methoxy-4-(trifluoromethyl)-
-
[94086-78-9]
Isopropyl 4-[4-[N,N-bis(2-hydroxyethyl)amino]phenyl]butyrate
-
[1808-26-0]
Ethyl arachidonate
-
[55382-52-0]
Methyl Divarinolcarboxylate
-
[1984-15-2]
Methylenediphosphonic acid
INDUSTRY LEADERS TRUST OUR PRODUCTS