2,4-Dichloro-5-nitropyridine - CAS 4487-56-3
Catalog: |
BB025719 |
Product Name: |
2,4-Dichloro-5-nitropyridine |
CAS: |
4487-56-3 |
Synonyms: |
2,4-dichloro-5-nitropyridine; 2,4-dichloro-5-nitropyridine |
IUPAC Name: | 2,4-dichloro-5-nitropyridine |
Description: | 2,4-Dichloro-5-nitropyridine (CAS# 4487-56-3) is used in the synthesis of potent and selective stearoyl-CoA desaturase (SCD) inhibitors. Also used in preparation of Rho-Kinase inhibitors displaying antihypertensive activity. |
Molecular Weight: | 192.99 |
Molecular Formula: | C5H2Cl2N2O2 |
Canonical SMILES: | C1=C(C(=CN=C1Cl)[N+](=O)[O-])Cl |
InChI: | InChI=1S/C5H2Cl2N2O2/c6-3-1-5(7)8-2-4(3)9(10)11/h1-2H |
InChI Key: | RZVJQUMDJUUBBF-UHFFFAOYSA-N |
Boiling Point: | 282.329 ℃ at 760 mmHg |
Density: | 1.63 g/cm3 |
MDL: | MFCD07368834 |
LogP: | 2.81980 |
GHS Hazard Statement: | H301 (20%): Toxic if swallowed [Danger Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P310, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
CN-113493436-A | Amino-substituted pyridine derivative and preparation method, pharmaceutical composition and application thereof | 20200403 |
WO-2021158707-A1 | Methods and compounds for the treatment of genetic disease | 20200203 |
WO-2021041237-A1 | Thyroid hormone receptor beta agonist compounds | 20190823 |
CN-112390852-A | Compound as protein degradation agent and preparation method and application thereof | 20190814 |
US-2021040115-A1 | Fused ring heteroaryl compounds as ripk1 inhibitors | 20190809 |
Complexity: | 161 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 191.9493327 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 191.9493327 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 58.7 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS