2,4-Dichloro-5-fluorobenzaldehyde - CAS 86522-91-0
Catalog: |
BB037976 |
Product Name: |
2,4-Dichloro-5-fluorobenzaldehyde |
CAS: |
86522-91-0 |
Synonyms: |
2,4-dichloro-5-fluorobenzaldehyde; 2,4-dichloro-5-fluorobenzaldehyde |
IUPAC Name: | 2,4-dichloro-5-fluorobenzaldehyde |
Description: | 2,4-Dichloro-5-fluorobenzaldehyde (CAS# 86522-91-0) is a useful research chemical. |
Molecular Weight: | 193.00 |
Molecular Formula: | C7H3Cl2FO |
Canonical SMILES: | C1=C(C(=CC(=C1F)Cl)Cl)C=O |
InChI: | InChI=1S/C7H3Cl2FO/c8-5-2-6(9)7(10)1-4(5)3-11/h1-3H |
InChI Key: | WGCCHXURNGWJIW-UHFFFAOYSA-N |
Boiling Point: | 58-59 °C / 14 mmHg |
Density: | 1.493 g/cm3 |
LogP: | 2.94500 |
Publication Number | Title | Priority Date |
AU-2016358242-A1 | N-substituted indole derivatives as PGE2 receptor modulators | 20151120 |
CA-3002610-A1 | N-substituted indole derivatives as pge2 receptor modulators | 20151120 |
EP-3377483-A1 | N-substituted indole derivatives as pge2 receptor modulators | 20151120 |
JP-2018534328-A | N-substituted indole derivatives as PGE2 receptor modulators | 20151120 |
KR-20180081810-A | N-substituted indole derivatives as PGE2 receptor modulators | 20151120 |
PMID | Publication Date | Title | Journal |
17521777 | 20080101 | Antimicrobial studies of 2,4-dichloro-5-fluorophenyl containing oxadiazoles | European journal of medicinal chemistry |
Complexity: | 153 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 191.9544983 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 191.9544983 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 17.1 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS