2,4-Dichloro-5-cyanopyrimidine - CAS 3177-24-0
Catalog: |
BB021053 |
Product Name: |
2,4-Dichloro-5-cyanopyrimidine |
CAS: |
3177-24-0 |
Synonyms: |
2,4-dichloro-5-pyrimidinecarbonitrile; 2,4-dichloropyrimidine-5-carbonitrile |
IUPAC Name: | 2,4-dichloropyrimidine-5-carbonitrile |
Description: | 2,4-Dichloro-5-cyanopyrimidine (CAS# 3177-24-0) is a useful research chemical. |
Molecular Weight: | 173.99 |
Molecular Formula: | C5HCl2N3 |
Canonical SMILES: | C1=C(C(=NC(=N1)Cl)Cl)C#N |
InChI: | InChI=1S/C5HCl2N3/c6-4-3(1-8)2-9-5(7)10-4/h2H |
InChI Key: | KMHSUNDEGHRBNV-UHFFFAOYSA-N |
Boiling Point: | 323.916 ℃ at 760 mmHg |
Density: | 1.607 g/cm3 |
MDL: | MFCD09746248 |
LogP: | 1.65508 |
GHS Hazard Statement: | H301 (90.48%): Toxic if swallowed [Danger Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P310, P302+P352, P304+P340, P311, P312, P321, P322, P330, P361, P363, P403+P233, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
CN-112592318-A | 2- (4-methionyl) anilino-4-aminopyrimidine derivatives and application thereof | 20201212 |
WO-2021163629-A1 | Inhibitors of ulk1/2 and methods of using same | 20200214 |
WO-2021138392-A1 | Aminopyrimidine compounds | 20191230 |
WO-2021104305-A1 | Nitrogen-containing polycyclic derivative inhibitor, preparation method therefor and application thereof | 20191126 |
US-2021047294-A1 | Imidazolyl pyrimidinylamine compounds as cdk2 inhibitors | 20190814 |
Complexity: | 164 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 172.9547524 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 172.9547524 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 49.6 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.8 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Nitrogen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS