2,4-Dibromo-N-methylaniline - CAS 73557-58-1
Catalog: |
BB034863 |
Product Name: |
2,4-Dibromo-N-methylaniline |
CAS: |
73557-58-1 |
Synonyms: |
2,4-dibromo-N-methylaniline |
IUPAC Name: | 2,4-dibromo-N-methylaniline |
Description: | 2,4-Dibromo-N-methylaniline (CAS# 73557-58-1 ) is a useful research chemical. |
Molecular Weight: | 264.95 |
Molecular Formula: | C7H7Br2N |
Canonical SMILES: | CNC1=C(C=C(C=C1)Br)Br |
InChI: | InChI=1S/C7H7Br2N/c1-10-7-3-2-5(8)4-6(7)9/h2-4,10H,1H3 |
InChI Key: | JZKJYNKHXCSGFX-UHFFFAOYSA-N |
Boiling Point: | 287.849 °C at 760 mmHg |
Density: | 1.876 g/cm3 |
MDL: | MFCD08276870 |
LogP: | 3.32630 |
GHS Hazard Statement: | H319 (100%): Causes serious eye irritation [Warning Serious eye damage/eye irritation] |
Precautionary Statement: | P264, P280, P305+P351+P338, and P337+P313 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CN-110563593-A | Preparation method of N-methyl-4-bromoaniline | 20190926 |
CN-111517902-A | Aerobic oxidation system containing sulfinic acid, sulfonic acid or derivatives thereof and photo-oxidation promoting method thereof | 20190201 |
WO-2020155595-A1 | Aerobic oxidation system containing sulfinic acid, sulfonic acid or derivatives thereof and photocatalytic oxidation method therefor | 20190201 |
EP-1885718-B1 | Fluorescent chemical compounds having high selectivity for double stranded dna, and methods for their use | 20050511 |
US-2006263844-A1 | Flourescent chemical compounds having high selectivity for double standard DNA, and methods for their use | 20050511 |
Complexity: | 108 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 264.89247 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 262.89452 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 12 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Nitrogen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS