2,4-Dibromo-1-(trifluoromethoxy)benzene - CAS 1840-97-7
Catalog: |
BB014115 |
Product Name: |
2,4-Dibromo-1-(trifluoromethoxy)benzene |
CAS: |
1840-97-7 |
Synonyms: |
2,4-dibromo-1-(trifluoromethoxy)benzene; 2,4-dibromo-1-(trifluoromethoxy)benzene |
IUPAC Name: | 2,4-dibromo-1-(trifluoromethoxy)benzene |
Description: | 2,4-Dibromo-1-(trifluoromethoxy)benzene (CAS# 1840-97-7 ) is a useful research chemical. |
Molecular Weight: | 319.90 |
Molecular Formula: | C7H3Br2F3O |
Canonical SMILES: | C1=CC(=C(C=C1Br)Br)OC(F)(F)F |
InChI: | InChI=1S/C7H3Br2F3O/c8-4-1-2-6(5(9)3-4)13-7(10,11)12/h1-3H |
InChI Key: | KKHVOILWGQCNJL-UHFFFAOYSA-N |
LogP: | 4.11020 |
Publication Number | Title | Priority Date |
EP-2614053-A1 | Method for producing pyridazinone compounds and intermediate thereof | 20100908 |
US-2013172556-A1 | Method for producing pyridazinone compounds and intermediate thereof | 20100908 |
US-2014378688-A1 | Method for producing pyridazinone compounds and intermediate thereof | 20100908 |
US-8884010-B2 | Method for producing pyridazinone compounds and intermediate thereof | 20100908 |
US-9040709-B2 | Method for producing pyridazinone compounds and intermediate thereof | 20100908 |
Complexity: | 174 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 319.84822 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 317.85027 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 9.2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 4.5 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Halides
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS