2-(4-Chlorophenyl)-2-(1-pyrrolidinyl)ethylamine - CAS 915923-59-0
Catalog: |
BB040268 |
Product Name: |
2-(4-Chlorophenyl)-2-(1-pyrrolidinyl)ethylamine |
CAS: |
915923-59-0 |
Synonyms: |
2-(4-chlorophenyl)-2-(1-pyrrolidinyl)ethanamine; 2-(4-chlorophenyl)-2-pyrrolidin-1-ylethanamine |
IUPAC Name: | 2-(4-chlorophenyl)-2-pyrrolidin-1-ylethanamine |
Description: | 2-(4-Chlorophenyl)-2-(1-pyrrolidinyl)ethylamine (CAS# 915923-59-0) is a useful research chemical. |
Molecular Weight: | 224.73 |
Molecular Formula: | C12H17ClN2 |
Canonical SMILES: | C1CCN(C1)C(CN)C2=CC=C(C=C2)Cl |
InChI: | InChI=1S/C12H17ClN2/c13-11-5-3-10(4-6-11)12(9-14)15-7-1-2-8-15/h3-6,12H,1-2,7-9,14H2 |
InChI Key: | UZOHZMOJLIOLON-UHFFFAOYSA-N |
Boiling Point: | 320.7 °C at 760 mmHg |
Density: | 1.176 g/cm3 |
LogP: | 3.07380 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P310, P312, P321, P330, P332+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
AU-2013328586-A1 | N-(2-(cyclic amine)ethyl)benzamide derivatives as P2x7 inhibitors | 20121012 |
AU-2013328586-B2 | N-(2-(cyclic amine)ethyl)benzamide derivatives as P2x7 inhibitors | 20121012 |
EP-2906549-A2 | Cyclic amines | 20121012 |
EP-2906549-B1 | N-(2-(cyclic amine)ethyl)benzamide derivatives as p2x7 inhibitors | 20121012 |
EP-3536689-A1 | 2-(cyclic amineethyl)benzamide derivatives as p2x7 inhibitors | 20121012 |
Complexity: | 184 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 224.1080262 |
Formal Charge: | 0 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 224.1080262 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 29.3 Å2 |
Undefined Atom Stereocenter Count: | 1 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS