2-(4-butylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane - CAS 625458-85-7
Catalog: |
BB055164 |
Product Name: |
2-(4-butylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
CAS: |
625458-85-7 |
Synonyms: |
2-(4-butylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane; 4-Butylphenylboronic acid pinacol ester; 1,3,2-Dioxaborolane, 2-(4-butylphenyl)-4,4,5,5-tetramethyl- |
IUPAC Name: | 2-(4-butylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
Molecular Weight: | 260.18 |
Molecular Formula: | C16H25BO2 |
Canonical SMILES: | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)CCCC |
InChI: | InChI=1S/C16H25BO2/c1-6-7-8-13-9-11-14(12-10-13)17-18-15(2,3)16(4,5)19-17/h9-12H,6-8H2,1-5H3 |
InChI Key: | CUOOVGGNLPMDIC-UHFFFAOYSA-N |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P317, P302+P352, P304+P340, P317, P321, P330, P362+P364, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
JP-2022518230-A | Antibacterial compounds and methods | 20190116 |
CA-2921082-A1 | Linear peptide antibiotics | 20130814 |
EP-3033352-A1 | Linear peptide antibiotics | 20130814 |
JP-2016528257-A | Linear peptide antibiotics | 20130814 |
KR-20160044512-A | Linear peptide antibiotics | 20130814 |
US-2016194358-A1 | Linear peptide antibiotcs | 20130814 |
WO-2015023898-A1 | Linear peptide antibiotcs | 20130814 |
CN-104903302-A | Macrocyclic broad spectrum antibiotics | 20121121 |
JP-2016501864-A | Macrocyclic antibiotics | 20121121 |
JP-2018184435-A | Macrocyclic wide-area antibiotics | 20121121 |
Complexity: | 277 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 260.1947602 |
Formal Charge: | 0 |
Heavy Atom Count: | 19 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 260.1947602 |
Rotatable Bond Count: | 4 |
Topological Polar Surface Area: | 18.5Ų |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Other Building Blocks
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS