2-(4-Bromophenyl)azetidine - CAS 1270542-80-7
Catalog: |
BB006726 |
Product Name: |
2-(4-Bromophenyl)azetidine |
CAS: |
1270542-80-7 |
Synonyms: |
2-(4-bromophenyl)azetidine; 2-(4-bromophenyl)azetidine |
IUPAC Name: | 2-(4-bromophenyl)azetidine |
Description: | 2-(4-Bromophenyl)azetidine (CAS# 1270542-80-7) is a useful research chemical. |
Molecular Weight: | 212.09 |
Molecular Formula: | C9H10BrN |
Canonical SMILES: | C1CNC1C2=CC=C(C=C2)Br |
InChI: | InChI=1S/C9H10BrN/c10-8-3-1-7(2-4-8)9-5-6-11-9/h1-4,9,11H,5-6H2 |
InChI Key: | KJWNZTPBMDNIPA-UHFFFAOYSA-N |
LogP: | 2.81230 |
GHS Hazard Statement: | H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CA-2905242-A1 | Indole compounds that activate ampk | 20130315 |
CA-2905242-C | Indole compounds that activate ampk | 20130315 |
CN-104045625-A | Indole and indazole compounds that activate ampk | 20130315 |
EP-2970177-A1 | Indole compounds that activate ampk | 20130315 |
JP-2016510805-A | Indazole compounds that activate AMPK | 20130315 |
Complexity: | 130 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 210.99966 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 210.99966 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 12 Å2 |
Undefined Atom Stereocenter Count: | 1 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Azetidines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS