2,4-Bis(chloromethyl)-1,3,5-trimethylbenzene - CAS 1585-17-7
Catalog: |
BB011424 |
Product Name: |
2,4-Bis(chloromethyl)-1,3,5-trimethylbenzene |
CAS: |
1585-17-7 |
Synonyms: |
2,4-bis(chloromethyl)-1,3,5-trimethylbenzene |
IUPAC Name: | 2,4-bis(chloromethyl)-1,3,5-trimethylbenzene |
Description: | 2,4-Bis(chloromethyl)-1,3,5-trimethylbenzene (CAS# 1585-17-7) is a useful research chemical. |
Molecular Weight: | 217.13 |
Molecular Formula: | C11H14Cl2 |
Canonical SMILES: | CC1=CC(=C(C(=C1CCl)C)CCl)C |
InChI: | InChI=1S/C11H14Cl2/c1-7-4-8(2)11(6-13)9(3)10(7)5-12/h4H,5-6H2,1-3H3 |
InChI Key: | JMNDJDCLOQRCJV-UHFFFAOYSA-N |
Boiling Point: | 180 ℃ (20 torr) |
Density: | 1.121 g/cm3 |
MDL: | MFCD00013681 |
LogP: | 4.08940 |
GHS Hazard Statement: | H314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation] |
Precautionary Statement: | P260, P264, P280, P301+P330+P331, P303+P361+P353, P304+P340, P305+P351+P338, P310, P321, P363, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
RU-2694261-C1 | Method of producing di-n,n'-oxides of 2,4,6-trialkylbenzene-1,3-dicarboxylic acid dinitriles | 20180423 |
AU-2018314833-A1 | Novel compounds activating the NRF2 pathway | 20170808 |
AU-2018314833-B2 | Novel compounds activating the NRF2 pathway | 20170808 |
CA-3066698-A1 | Novel compounds activating the nrf2 pathway | 20170808 |
CN-110997695-A | Novel compounds that activate the Nrf2 pathway | 20170808 |
Complexity: | 142 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 216.0472558 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 0 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 216.0472558 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 0 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.8 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Halides
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS