2-[4-(Aminomethyl)phenyl]-6-methylbenzoxazole - CAS 875000-08-1
Catalog: |
BB038508 |
Product Name: |
2-[4-(Aminomethyl)phenyl]-6-methylbenzoxazole |
CAS: |
875000-08-1 |
Synonyms: |
[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]methanamine; [4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]methanamine |
IUPAC Name: | [4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]methanamine |
Description: | 2-[4-(Aminomethyl)phenyl]-6-methylbenzoxazole (CAS# 875000-08-1 ) is a useful research chemical. |
Molecular Weight: | 238.28 |
Molecular Formula: | C15H14N2O |
Canonical SMILES: | CC1=CC2=C(C=C1)N=C(O2)C3=CC=C(C=C3)CN |
InChI: | InChI=1S/C15H14N2O/c1-10-2-7-13-14(8-10)18-15(17-13)12-5-3-11(9-16)4-6-12/h2-8H,9,16H2,1H3 |
InChI Key: | VHBQFBZSMNLDCO-UHFFFAOYSA-N |
Publication Number | Title | Priority Date |
KR-20210052335-A | Composition for preventing or inhibiting axonal degeneration | 20191031 |
WO-2021086076-A1 | Composition for preventing or inhibiting axonal degeneration | 20191031 |
EP-3431472-A2 | Novel compound for inhibiting nicotinamide phosphoribosyltransferase and composition containing same | 20160317 |
JP-2019512503-A | Novel compound for inhibiting nicotinamide phosphoribosyltransferase and composition containing the same | 20160317 |
KR-101893997-B1 | Novel compound for inhibiting NamPT and composition comprising the same | 20160317 |
Complexity: | 276 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 238.110613074 |
Formal Charge: | 0 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 238.110613074 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 52 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS