2,4,6-Trichlorobenzenesulfonyl chloride - CAS 51527-73-2
Catalog: |
BB027477 |
Product Name: |
2,4,6-Trichlorobenzenesulfonyl chloride |
CAS: |
51527-73-2 |
Synonyms: |
2,4,6-trichlorobenzenesulfonyl chloride |
IUPAC Name: | 2,4,6-trichlorobenzenesulfonyl chloride |
Description: | 2,4,6-Trichlorobenzenesulfonyl chloride (CAS# 51527-73-2) is a useful research chemical. |
Molecular Weight: | 279.96 |
Molecular Formula: | C6H2Cl4O2S |
Canonical SMILES: | C1=C(C=C(C(=C1Cl)S(=O)(=O)Cl)Cl)Cl |
InChI: | InChI=1S/C6H2Cl4O2S/c7-3-1-4(8)6(5(9)2-3)13(10,11)12/h1-2H |
InChI Key: | WHJAQKAAIOHCGN-UHFFFAOYSA-N |
Boiling Point: | 341 °C at 760 mmHg |
Melting Point: | 44-48 °C (lit.) |
Purity: | 95 % |
Density: | 1.728 g/cm3 |
Appearance: | White to yellow solid |
MDL: | MFCD00052973 |
LogP: | 4.65510 |
GHS Hazard Statement: | H314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation] |
Precautionary Statement: | P260, P264, P280, P301+P330+P331, P303+P361+P353, P304+P340, P305+P351+P338, P310, P321, P363, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
CN-111689900-A | Aryl pyrazole sulfonyl hydrazide metal complex and ultrasonic radiation synthesis method and application thereof | 20200616 |
CN-111689900-B | Aryl pyrazole sulfonyl hydrazide metal complex and ultrasonic radiation synthesis method and application thereof | 20200616 |
WO-2020045534-A1 | Active-light-sensitive or radiation-sensitive resin composition, active-light-sensitive or radiation-sensitive film, pattern formation method, method for manufacturing electronic device, and compound | 20180831 |
TW-202020566-A | Photosensitive or radioactive resin composition, photosensitive or radioactive film, pattern forming method, electronic device manufacturing method and compound | 20180831 |
US-2021165325-A1 | Actinic ray-sensitive or radiation-sensitive resin composition, actinic ray-sensitive or radiation-sensitive film, pattern forming method, method for manufacturing electronic device, and compound | 20180831 |
Complexity: | 261 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 279.850011 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 277.852961 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 42.5 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.8 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Sulfur Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS