2,3-Dimethylindole-5-carboxylic Acid - CAS 14844-73-6
Catalog: |
BB010302 |
Product Name: |
2,3-Dimethylindole-5-carboxylic Acid |
CAS: |
14844-73-6 |
Synonyms: |
2,3-dimethyl-1H-indole-5-carboxylic acid; 2,3-dimethyl-1H-indole-5-carboxylic acid |
IUPAC Name: | 2,3-dimethyl-1H-indole-5-carboxylic acid |
Description: | 2,3-Dimethylindole-5-carboxylic Acid (CAS# 14844-73-6) is a useful research chemical. |
Molecular Weight: | 189.21 |
Molecular Formula: | C11H11NO2 |
Canonical SMILES: | CC1=C(NC2=C1C=C(C=C2)C(=O)O)C |
InChI: | InChI=1S/C11H11NO2/c1-6-7(2)12-10-4-3-8(11(13)14)5-9(6)10/h3-5,12H,1-2H3,(H,13,14) |
InChI Key: | KHJGIMZYCBPOBG-UHFFFAOYSA-N |
Boiling Point: | 424.6 ℃ at 760 mmHg |
Density: | 1.287 g/cm3; |
MDL: | MFCD00464053 |
LogP: | 2.48290 |
GHS Hazard Statement: | H302 (50%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P322, P330, P332+P313, P337+P313, P362, P363, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021173593-A1 | Indole compounds for the treatment of neurodegenerative diseases | 20200224 |
WO-2020172565-A1 | Methods and materials for increasing or maintaining nicotinamide mononucleotide adenylyl transferase-2 (nmnat2) polypeptide levels | 20190222 |
US-2017174688-A1 | Substituted Indoles | 20141218 |
US-2017349589-A9 | Substituted Indoles | 20141218 |
US-9932340-B2 | Substituted indoles | 20141218 |
Complexity: | 241 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 189.078978594 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 189.078978594 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 53.1 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS