2,3-Diiodo-pyridine - CAS 83674-70-8
Catalog: |
BB037079 |
Product Name: |
2,3-Diiodo-pyridine |
CAS: |
83674-70-8 |
Synonyms: |
2,3-diiodopyridine |
IUPAC Name: | 2,3-diiodopyridine |
Description: | 2,3-Diiodo-pyridine (CAS# 83674-70-8) is a useful research chemical. |
Molecular Weight: | 330.89 |
Molecular Formula: | C5H3I2N |
Canonical SMILES: | C1=CC(=C(N=C1)I)I |
InChI: | InChI=1S/C5H3I2N/c6-4-2-1-3-8-5(4)7/h1-3H |
InChI Key: | AQWGOTHUVVKPTG-UHFFFAOYSA-N |
Boiling Point: | 305.303 ℃ at 760 mmHg |
Density: | 2.609 g/cm3 |
MDL: | MFCD06658996 |
LogP: | 2.29080 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P310, P312, P321, P330, P332+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
CN-107854720-A | Medicine-carried polyhydroxylated polymer embolism microball with radiography function and preparation method thereof | 20171228 |
WO-2019129237-A1 | Medicine carriable polyhydroxylated polymer embolism microsphere having contrast function and preparation method therefor | 20171228 |
CN-108948019-A | Focal adhesion kinase inhibitor and application thereof | 20170518 |
JP-2018076251-A | Compound, luminescent or electronic material using the same, and gas sensor material | 20161108 |
JP-6833188-B2 | Compounds, light emitting or electronic materials using them, and gas sensor materials | 20161108 |
PMID | Publication Date | Title | Journal |
11896696 | 20020325 | A simultaneous reduction, substitution, and self-assembly reaction under hydrothermal conditions afforded the first diiodopyridine copper(I) coordination polymer | Inorganic chemistry |
Complexity: | 76.8 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 330.83549 |
Formal Charge: | 0 |
Heavy Atom Count: | 8 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 330.83549 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 12.9 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS