2,3-Dihydro-5-(hydroxymethyl)benzo[1,4]dioxine - CAS 274910-19-9
Catalog: |
BB019589 |
Product Name: |
2,3-Dihydro-5-(hydroxymethyl)benzo[1,4]dioxine |
CAS: |
274910-19-9 |
Synonyms: |
2,3-dihydro-1,4-benzodioxin-5-ylmethanol; 2,3-dihydro-1,4-benzodioxin-5-ylmethanol |
IUPAC Name: | 2,3-dihydro-1,4-benzodioxin-5-ylmethanol |
Description: | 2,3-Dihydro-5-(hydroxymethyl)benzo[1,4]dioxine (CAS# 274910-19-9) is a useful research chemical compound. |
Molecular Weight: | 166.17 |
Molecular Formula: | C9H10O3 |
Canonical SMILES: | C1COC2=C(C=CC=C2O1)CO |
InChI: | InChI=1S/C9H10O3/c10-6-7-2-1-3-8-9(7)12-5-4-11-8/h1-3,10H,4-6H2 |
InChI Key: | WATIARBIFSKYKC-UHFFFAOYSA-N |
Boiling Point: | 306.4 °C at 760 mmHg |
Density: | 1.257 g/cm3 |
LogP: | 0.95010 |
Publication Number | Title | Priority Date |
WO-2021124172-A1 | 3-(5-methoxy-1-oxoisoindolin-2-yl)piperidine-2,6-dione derivatives and uses thereof | 20191218 |
CN-110896637-A | Pyrano quinazoline derivatives and naphthopyran derivatives | 20170314 |
EP-3597652-A1 | Pyranoquinazoline derivative and naphthopyran derivative | 20170314 |
JP-WO2018168232-A1 | Pyranoquinazoline derivative and naphthopyran derivative | 20170314 |
KR-20190129922-A | Pyranoquinazoline Derivatives and Naphthopyran Derivatives | 20170314 |
Complexity: | 149 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 166.062994177 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 166.062994177 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 38.7 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.8 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Alcohols and Derivatives
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS