2,3-Dihydro-1H-pyrido[2,3-b][1,4]oxazine - CAS 1112193-37-9
Catalog: |
BB002739 |
Product Name: |
2,3-Dihydro-1H-pyrido[2,3-b][1,4]oxazine |
CAS: |
1112193-37-9 |
Synonyms: |
2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine |
IUPAC Name: | 2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine |
Description: | 2,3-Dihydro-1H-pyrido[2,3-b][1,4]oxazine (CAS# 1112193-37-9) is a useful research chemical. |
Molecular Weight: | 136.15 |
Molecular Formula: | C7H8N2O |
Canonical SMILES: | C1COC2=C(N1)C=CC=N2 |
InChI: | InChI=1S/C7H8N2O/c1-2-6-7(9-3-1)10-5-4-8-6/h1-3,8H,4-5H2 |
InChI Key: | LTWFBZQFHPDLNU-UHFFFAOYSA-N |
MDL: | MFCD08692103 |
LogP: | 1.02390 |
GHS Hazard Statement: | H319 (100%): Causes serious eye irritation [Warning Serious eye damage/eye irritation] |
Precautionary Statement: | P264, P280, P305+P351+P338, and P337+P313 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021210586-A1 | Condensed heterocyclic compound | 20200414 |
US-2021079014-A1 | Functionalized heterocycles as antiviral agents | 20190917 |
WO-2021032148-A1 | Aminopyrazine compounds as hpk1 inhibitor and the use thereof | 20190821 |
WO-2021021761-A1 | Urea, amide, and substituted heteroaryl compounds for cbl-b inhibition | 20190730 |
WO-2020254493-A1 | Thienylhydroxyisoxazolines and derivatives thereof | 20190621 |
Complexity: | 118 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 136.063662883 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 136.063662883 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 34.2 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS