2,3-Dichloro-6-methylaniline - CAS 62077-27-4
Catalog: |
BB031405 |
Product Name: |
2,3-Dichloro-6-methylaniline |
CAS: |
62077-27-4 |
Synonyms: |
2,3-dichloro-6-methylaniline; 2,3-dichloro-6-methylaniline |
IUPAC Name: | 2,3-dichloro-6-methylaniline |
Description: | 2,3-Dichloro-6-methylaniline (CAS# 62077-27-4 ) is a useful research chemical. |
Molecular Weight: | 176.04 |
Molecular Formula: | C7H7Cl2N |
Canonical SMILES: | CC1=C(C(=C(C=C1)Cl)Cl)N |
InChI: | InChI=1S/C7H7Cl2N/c1-4-2-3-5(8)6(9)7(4)10/h2-3H,10H2,1H3 |
InChI Key: | KSJUCTMXLJIVIE-UHFFFAOYSA-N |
LogP: | 3.46520 |
Publication Number | Title | Priority Date |
US-2020317622-A1 | Pyrimidinone derivatives as shp2 antagonists | 20190408 |
WO-2020210384-A1 | Pyrimidinone derivatives as shp2 antagonists | 20190408 |
US-11001561-B2 | Pyrimidinone derivatives as SHP2 antagonists | 20190408 |
US-2021179565-A1 | Pyrimidinone derivatives as shp2 antagonists | 20190408 |
US-2018028492-A1 | Compounds and compositions and uses thereof | 20160729 |
Complexity: | 118 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 174.9955546 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 174.9955546 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 26 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS