2,3-Dibromo-5-nitropyridine - CAS 15862-36-9
Catalog: |
BB011447 |
Product Name: |
2,3-Dibromo-5-nitropyridine |
CAS: |
15862-36-9 |
Synonyms: |
2,3-dibromo-5-nitropyridine; 2,3-dibromo-5-nitropyridine |
IUPAC Name: | 2,3-dibromo-5-nitropyridine |
Description: | 2,3-Dibromo-5-nitropyridine (CAS# 15862-36-9) is a useful research chemical. |
Molecular Weight: | 281.89 |
Molecular Formula: | C5H2Br2N2O2 |
Canonical SMILES: | C1=C(C=NC(=C1Br)Br)[N+](=O)[O-] |
InChI: | InChI=1S/C5H2Br2N2O2/c6-4-1-3(9(10)11)2-8-5(4)7/h1-2H |
InChI Key: | BPMGYPAEPOYAMW-UHFFFAOYSA-N |
Boiling Point: | 311.4 °C at 760 mmHg |
Density: | 2.221 g/cm3 |
MDL: | MFCD00233994 |
LogP: | 3.03800 |
Publication Number | Title | Priority Date |
WO-2021195781-A1 | Compounds, pharmaceutical compositions, and methods of preparing compounds and of their use | 20200401 |
WO-2021195782-A1 | Methods of using myt1 inhibitors | 20200401 |
CN-108314680-A | One kind containing aromatic compound, preparation method, pharmaceutical composition and application | 20170116 |
WO-2016046782-A1 | Imidazole biaryl compounds as s-nitrosoglutathione reductase inhibitors | 20140926 |
CN-105593232-B | Benzoxazoles and oxazines ketone compounds as coagulation factor xa inhibitors | 20130929 |
Complexity: | 161 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 281.84625 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 279.8483 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 58.7 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS