2,3-Dibromo-5-methylpyridine - CAS 29232-39-1
Catalog: |
BB020135 |
Product Name: |
2,3-Dibromo-5-methylpyridine |
CAS: |
29232-39-1 |
Synonyms: |
2,3-dibromo-5-methylpyridine |
IUPAC Name: | 2,3-dibromo-5-methylpyridine |
Description: | 2,3-Dibromo-5-methylpyridine (CAS# 29232-39-1) is a useful research chemical. |
Molecular Weight: | 250.92 |
Molecular Formula: | C6H5Br2N |
Canonical SMILES: | CC1=CC(=C(N=C1)Br)Br |
InChI: | InChI=1S/C6H5Br2N/c1-4-2-5(7)6(8)9-3-4/h2-3H,1H3 |
InChI Key: | BZUZAZMAGVFIBS-UHFFFAOYSA-N |
Boiling Point: | 270.8 ℃ at 760 mmHg |
Purity: | 98 % |
Density: | 1.911 g/cm3 |
MDL: | MFCD04112574 |
LogP: | 2.91500 |
GHS Hazard Statement: | H301 (97.56%): Toxic if swallowed [Danger Acute toxicity, oral] |
Precautionary Statement: | P264, P270, P280, P301+P310, P305+P351+P338, P310, P321, P330, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
CN-107011387-A | Compound and its electronic component being made | 20160127 |
CN-107011387-B | Compound and its manufactured electronic component | 20160127 |
TW-201726699-A | Compound and its electronic components | 20160127 |
TW-I632148-B | Compound and its electronic components | 20160127 |
US-2017213990-A1 | Compound and electronic device including same | 20160127 |
Complexity: | 97.1 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 250.87682 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 248.87887 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 12.9 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS