2-(3-Bromophenyl)propanoic Acid - CAS 53086-52-5
Catalog: |
BB028044 |
Product Name: |
2-(3-Bromophenyl)propanoic Acid |
CAS: |
53086-52-5 |
Synonyms: |
2-(3-bromophenyl)propanoic acid; 2-(3-bromophenyl)propanoic acid |
IUPAC Name: | 2-(3-bromophenyl)propanoic acid |
Description: | 2-(3-Bromophenyl)propanoic Acid (CAS# 53086-52-5) is an intermediate in the synthesis of Ketoprofen (K200800) related compounds. |
Molecular Weight: | 229.07 |
Molecular Formula: | C9H9BrO2 |
Canonical SMILES: | CC(C1=CC(=CC=C1)Br)C(=O)O |
InChI: | InChI=1S/C9H9BrO2/c1-6(9(11)12)7-3-2-4-8(10)5-7/h2-6H,1H3,(H,11,12) |
InChI Key: | QLHMQZFTSIHQIT-UHFFFAOYSA-N |
Boiling Point: | 319.6 ℃ at 760 mmHg |
Density: | 1.523 g/cm3 |
Appearance: | Liquid |
LogP: | 2.63720 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
KR-20210116323-A | Novel compounds of inhibiting cdk7, and their pharmaceutically acceptable salts | 20200313 |
WO-2021182914-A1 | Novel cdk7 inhibitory compound or pharmaceutically acceptable salt thereof | 20200313 |
WO-2020061261-A1 | Inhibiting ubiquitin specific peptidase 9x | 20180919 |
CN-113164571-A | Inhibition of ubiquitin-specific peptidase 9X | 20180919 |
EP-3852790-A1 | Inhibiting ubiquitin specific peptidase 9x | 20180919 |
Complexity: | 170 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 227.97859 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 227.97859 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 37.3 Å2 |
Undefined Atom Stereocenter Count: | 1 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.5 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS