2,3,5-Trichlorobenzoic acid - CAS 50-73-7
Catalog: |
BB027201 |
Product Name: |
2,3,5-Trichlorobenzoic acid |
CAS: |
50-73-7 |
Synonyms: |
Benzoic acid, 2,3,5-trichloro- |
IUPAC Name: | 2,3,5-trichlorobenzoic acid |
Molecular Weight: | 225.46 |
Molecular Formula: | C7H3Cl3O2 |
Canonical SMILES: | C1=C(C=C(C(=C1Cl)Cl)C(=O)O)Cl |
InChI: | InChI=1S/C7H3Cl3O2/c8-3-1-4(7(11)12)6(10)5(9)2-3/h1-2H,(H,11,12) |
InChI Key: | CGFDSIZRJWMQPP-UHFFFAOYSA-N |
Boiling Point: | 329.4±37.0°C at 760 mmHg |
Melting Point: | 164°C |
Purity: | 95% |
Density: | 1.635±0.06 g/cm3 |
Solubility: | Soluble in Acetonitrile (Slightly), DMSO (Slightly) |
Appearance: | White to Pale Brown Solid |
Storage: | Store at -20°C under inert atmosphere |
MDL: | MFCD00060674 |
LogP: | 3.34500 |
GHS Hazard Statement: | H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021170886-A2 | Electronic device | 20200806 |
DE-102015116389-A1 | Organic electronic device with carrier generation layer and use of a zinc complex as a p-type dopant in carrier generation layers | 20150928 |
US-10581001-B2 | Organic electronic component having a charge carrier generation layer and the use of a zinc complex as a P-type dopant in charge carrier generation layers | 20150928 |
US-2018277778-A1 | Organic electronic component having a charge carrier generation layer and the use of a zinc complex as a p-type dopant in charge carrier generation layers | 20150928 |
WO-2017055283-A1 | Organic electronic component having a charge generation layer and use of a zinc complex as a p-dopant in charge generation layers | 20150928 |
PMID | Publication Date | Title | Journal |
19817384 | 20091112 | Phenoxy herbicides and fibrates potently inhibit the human chemosensory receptor subunit T1R3 | Journal of medicinal chemistry |
17804121 | 20080401 | Synthesis, antimicrobial and anti-inflammatory activities of some 1,2,4-triazolo[3,4-b][1,3,4]thiadiazoles and 1,2,4-triazolo[3,4-b][1,3,4]thiadiazines bearing trichlorophenyl moiety | European journal of medicinal chemistry |
15620745 | 20050101 | Diversity of biphenyl degraders in a chlorobenzene polluted aquifer | Chemosphere |
Complexity: | 186 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 223.919862 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 223.919862 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 37.3 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS