2-(3,5-Dichlorophenyl)ethanamine - CAS 67851-51-8
Catalog: |
BB033418 |
Product Name: |
2-(3,5-Dichlorophenyl)ethanamine |
CAS: |
67851-51-8 |
Synonyms: |
2-(3,5-dichlorophenyl)ethanamine; 2-(3,5-dichlorophenyl)ethanamine |
IUPAC Name: | 2-(3,5-dichlorophenyl)ethanamine |
Description: | 2-(3,5-Dichlorophenyl)ethanamine (CAS# 67851-51-8) is a useful research chemical. |
Molecular Weight: | 190.07 |
Molecular Formula: | C8H9Cl2N |
Canonical SMILES: | C1=C(C=C(C=C1Cl)Cl)CCN |
InChI: | InChI=1S/C8H9Cl2N/c9-7-3-6(1-2-11)4-8(10)5-7/h3-5H,1-2,11H2 |
InChI Key: | HEEUTZAJXBKBEJ-UHFFFAOYSA-N |
MDL: | MFCD08448789 |
LogP: | 3.19490 |
GHS Hazard Statement: | H314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation] |
Precautionary Statement: | P260, P261, P264, P271, P280, P301+P330+P331, P303+P361+P353, P304+P340, P305+P351+P338, P310, P312, P321, P363, P403+P233, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
WO-2020205455-A1 | Peripheral alkyl and alkenyl chains extended benzene derivatives and pharmaceutical composition including the same | 20190329 |
WO-2010018867-A1 | Di-substituted benzopyrane compound | 20080814 |
AU-2009262274-A1 | 6-substituted phenoxychroman carboxylic acid derivatives | 20080625 |
AU-2009262274-B2 | 6-substituted phenoxychroman carboxylic acid derivatives | 20080625 |
CA-2729217-A1 | 6-substituted phenoxychroman carboxylic acid derivatives | 20080625 |
Complexity: | 109 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 189.0112047 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 189.0112047 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 26 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.5 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS