2-(3,4,5-Trifluorophenyl)aniline - CAS 915416-45-4
Catalog: |
BB040237 |
Product Name: |
2-(3,4,5-Trifluorophenyl)aniline |
CAS: |
915416-45-4 |
Synonyms: |
2-(3,4,5-trifluorophenyl)aniline; 2-(3,4,5-trifluorophenyl)aniline |
IUPAC Name: | 2-(3,4,5-trifluorophenyl)aniline |
Description: | 2-(3,4,5-Trifluorophenyl)aniline (CAS# 915416-45-4) is a building block used in various chemical synthesis. |
Molecular Weight: | 223.19 |
Molecular Formula: | C12H8F3N |
Canonical SMILES: | C1=CC=C(C(=C1)C2=CC(=C(C(=C2)F)F)F)N |
InChI: | InChI=1S/C12H8F3N/c13-9-5-7(6-10(14)12(9)15)8-3-1-2-4-11(8)16/h1-6H,16H2 |
InChI Key: | FTIKVBVUYPQUBF-UHFFFAOYSA-N |
LogP: | 3.93430 |
GHS Hazard Statement: | H317 (72.73%): May cause an allergic skin reaction [Warning Sensitization, Skin] |
Precautionary Statement: | P261, P264, P272, P273, P280, P302+P352, P305+P351+P338, P321, P333+P313, P337+P313, P363, P391, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021122645-A1 | Pesticidally active azole-amide compounds | 20191220 |
WO-2021110891-A1 | Pesticidally active fused bicyclic heteroaromatic amino compounds | 20191204 |
WO-2021083936-A1 | Pesticidally active fused bicyclic heteroaromatic compounds | 20191101 |
WO-2021074309-A1 | 1-(3-quinolyl)-3,4-dihydroisoquinoline derivatives as fungicides for combating specific phytopathogens | 20191016 |
WO-2021074311-A1 | 1-(3-quinolyl)-1,2,3,4-tetrahydroisoquinoline derivatives as fungicides for combating specific phytopathogens | 20191016 |
Complexity: | 224 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 223.06088375 |
Formal Charge: | 0 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 223.06088375 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 26 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS