2-(2-Thiazolylthio)acetic Acid - CAS 5685-16-5
Catalog: |
BB029511 |
Product Name: |
2-(2-Thiazolylthio)acetic Acid |
CAS: |
5685-16-5 |
Synonyms: |
2-(2-thiazolylthio)acetic acid; 2-(1,3-thiazol-2-ylsulfanyl)acetic acid |
IUPAC Name: | 2-(1,3-thiazol-2-ylsulfanyl)acetic acid |
Description: | 2-(2-Thiazolylthio)acetic Acid (CAS# 5685-16-5) is a useful research chemical. |
Molecular Weight: | 175.23 |
Molecular Formula: | C5H5NO2S2 |
Canonical SMILES: | C1=CSC(=N1)SCC(=O)O |
InChI: | InChI=1S/C5H5NO2S2/c7-4(8)3-10-5-6-1-2-9-5/h1-2H,3H2,(H,7,8) |
InChI Key: | YLPVEUBTBBTBIT-UHFFFAOYSA-N |
LogP: | 1.31980 |
Publication Number | Title | Priority Date |
EP-0405976-A1 | Azole derivatives and antiulcerative composition containing same | 19890629 |
EP-0405976-B1 | Azole derivatives and antiulcerative composition containing same | 19890629 |
GB-2227746-A | Nitromethane derivatives | 19890206 |
US-4507487-A | Chemical compounds | 19820923 |
Complexity: | 131 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 174.97617075 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 174.97617075 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 104 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS