2-(2-Phenylethyl)piperidine - CAS 159053-39-1
Catalog: |
BB011490 |
Product Name: |
2-(2-Phenylethyl)piperidine |
CAS: |
159053-39-1 |
Synonyms: |
2-(2-phenylethyl)piperidine |
IUPAC Name: | 2-(2-phenylethyl)piperidine |
Description: | 2-(2-Phenylethyl)piperidine (CAS# 159053-39-1) is a useful research chemical. |
Molecular Weight: | 189.30 |
Molecular Formula: | C13H19N |
Canonical SMILES: | C1CCNC(C1)CCC2=CC=CC=C2 |
InChI: | InChI=1S/C13H19N/c1-2-6-12(7-3-1)9-10-13-8-4-5-11-14-13/h1-3,6-7,13-14H,4-5,8-11H2 |
InChI Key: | MOUYVILUKZKNDE-UHFFFAOYSA-N |
Boiling Point: | 289.6 °C at 760 mmHg |
Purity: | 95 % |
Density: | 0.942 g/cm3 |
MDL: | MFCD02663650 |
LogP: | 3.09010 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
US-2020283459-A1 | Group 5 metal complexes for catalytic amine functionalization | 20170526 |
US-11034707-B2 | Group 5 metal complexes for catalytic amine functionalization | 20170526 |
US-2020352921-A1 | Aryl-sulfonamide and aryl-sulfone derivatives as trpml modulators | 20170507 |
CA-2866302-A1 | Carbamate compounds and of making and using same | 20120319 |
EP-2828253-A1 | Carbamate compounds and of making and using same | 20120319 |
Complexity: | 149 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 189.151749610 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 189.151749610 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 12 Å2 |
Undefined Atom Stereocenter Count: | 1 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Piperidines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS