2-(2-Methyl-4-thiazolyl)aniline - CAS 305811-38-5
Catalog: |
BB020653 |
Product Name: |
2-(2-Methyl-4-thiazolyl)aniline |
CAS: |
305811-38-5 |
Synonyms: |
2-(2-methyl-4-thiazolyl)aniline; 2-(2-methyl-1,3-thiazol-4-yl)aniline |
IUPAC Name: | 2-(2-methyl-1,3-thiazol-4-yl)aniline |
Description: | 2-(2-Methyl-4-thiazolyl)aniline (CAS# 305811-38-5) is a useful research chemical. |
Molecular Weight: | 190.26 |
Molecular Formula: | C10H10N2S |
Canonical SMILES: | CC1=NC(=CS1)C2=CC=CC=C2N |
InChI: | InChI=1S/C10H10N2S/c1-7-12-10(6-13-7)8-4-2-3-5-9(8)11/h2-6H,11H2,1H3 |
InChI Key: | AJFBHXXQTQAILP-UHFFFAOYSA-N |
MDL: | MFCD09965287 |
LogP: | 3.28190 |
Publication Number | Title | Priority Date |
JP-2016001567-A | Electrolytic solution and secondary battery using the same | 20140612 |
EP-1813606-A1 | Amide compound | 20041118 |
EP-1175406-A1 | Imidazoline derivatives as alpha-1a adrenoceptor ligands | 19990430 |
JP-2002543187-A | Imidazoline derivatives as α-1A adrenergic receptor ligands | 19990430 |
US-6884801-B1 | Imidazoline derivatives as alpha-1A adrenoceptor ligands | 19990430 |
Complexity: | 174 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 190.0564695 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 190.0564695 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 67.2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS