2,2-Dimethylcyclopropanamine Hydrochloride - CAS 674367-28-3
Catalog: |
BB033275 |
Product Name: |
2,2-Dimethylcyclopropanamine Hydrochloride |
CAS: |
674367-28-3 |
Synonyms: |
2,2-dimethyl-1-cyclopropanamine;hydrochloride; 2,2-dimethylcyclopropan-1-amine;hydrochloride |
IUPAC Name: | 2,2-dimethylcyclopropan-1-amine;hydrochloride |
Description: | 2,2-Dimethylcyclopropanamine Hydrochloride (CAS# 674367-28-3) is a useful research chemical. |
Molecular Weight: | 121.61 |
Molecular Formula: | C5H12ClN |
Canonical SMILES: | CC1(CC1N)C.Cl |
InChI: | InChI=1S/C5H11N.ClH/c1-5(2)3-4(5)6;/h4H,3,6H2,1-2H3;1H |
InChI Key: | LIVDXAAZXJCHPC-UHFFFAOYSA-N |
LogP: | 2.24590 |
GHS Hazard Statement: | H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021130259-A1 | Dihydrocyclopenta-isoquinoline-sulfonamide derivatives compounds | 20191223 |
US-2021015822-A1 | Substituted amino triazoles useful as chitinase inhibitors | 20190715 |
WO-2021009209-A1 | Substituted amino triazoles useful as chitinase inhibitors | 20190715 |
AU-2012295802-A1 | Tricyclic heterocyclic compounds and JAK inhibitors | 20110812 |
AU-2012295802-B2 | Tricyclic heterocyclic compounds and JAK inhibitors | 20110812 |
Complexity: | 66.3 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 2 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 121.0658271 |
Formal Charge: | 0 |
Heavy Atom Count: | 7 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 121.0658271 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 26 Å2 |
Undefined Atom Stereocenter Count: | 1 |
Undefined Bond Stereocenter Count: | 0 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS