2,2-Dimethyl-N-(4-methyl-2-pyridyl)propionamide - CAS 86847-77-0
Catalog: |
BB038090 |
Product Name: |
2,2-Dimethyl-N-(4-methyl-2-pyridyl)propionamide |
CAS: |
86847-77-0 |
Synonyms: |
2,2-dimethyl-N-(4-methyl-2-pyridinyl)propanamide; 2,2-dimethyl-N-(4-methylpyridin-2-yl)propanamide |
IUPAC Name: | 2,2-dimethyl-N-(4-methylpyridin-2-yl)propanamide |
Description: | 2,2-Dimethyl-N-(4-methyl-2-pyridyl)propionamide (CAS# 86847-77-0) is a useful research chemical. |
Molecular Weight: | 192.26 |
Molecular Formula: | C11H16N2O |
Canonical SMILES: | CC1=CC(=NC=C1)NC(=O)C(C)(C)C |
InChI: | InChI=1S/C11H16N2O/c1-8-5-6-12-9(7-8)13-10(14)11(2,3)4/h5-7H,1-4H3,(H,12,13,14) |
InChI Key: | GMKUFMYZJOPWSH-UHFFFAOYSA-N |
LogP: | 2.44760 |
Publication Number | Title | Priority Date |
WO-2021105474-A1 | New compounds for treatment of diseases related to dux4 expression | 20191129 |
US-2018072688-A1 | Certain chemical entities, compositions, and methods | 20160815 |
US-2020172495-A1 | Certain chemical entities, compositions, and methods | 20160815 |
AU-2017287902-A1 | [1,2,4]triazolo[1,5-a]pyridinyl substituted indole compounds | 20160629 |
EP-3478682-A1 | [1,2,4]triazolo[1,5-a]pyridinyl substituted indole compounds | 20160629 |
Complexity: | 208 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 192.126263138 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 192.126263138 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 42 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS