2,2-Dimethyl-1H-indene-1,3(2H)-dione - CAS 17190-77-1
Catalog: |
BB012778 |
Product Name: |
2,2-Dimethyl-1H-indene-1,3(2H)-dione |
CAS: |
17190-77-1 |
Synonyms: |
2,2-dimethylindene-1,3-dione; 2,2-dimethylindene-1,3-dione |
IUPAC Name: | 2,2-dimethylindene-1,3-dione |
Description: | 2,2-Dimethyl-1H-indene-1,3(2H)-dione (CAS# 17190-77-1) is a useful research chemical. |
Molecular Weight: | 174.20 |
Molecular Formula: | C11H10O2 |
Canonical SMILES: | CC1(C(=O)C2=CC=CC=C2C1=O)C |
InChI: | InChI=1S/C11H10O2/c1-11(2)9(12)7-5-3-4-6-8(7)10(11)13/h3-6H,1-2H3 |
InChI Key: | BNPBWSGZTORGIH-UHFFFAOYSA-N |
LogP: | 2.09180 |
Publication Number | Title | Priority Date |
CN-105693608-A | 2, 2-dimethyl-1, 3-indandione derivatives and organic electroluminescence device based on same | 20160324 |
CN-105693608-B | 2,2- dimethyl -1,3- indene-dione derivatives and the organic electroluminescence device based on it | 20160324 |
US-2017050918-A1 | Process for preparing symmetric pincer ligands from the group of the m-terphenyl compounds | 20150821 |
US-2017305846-A1 | 2,2' -diaminobiaryls having a phthaloyl group or succinoyl group | 20140903 |
US-10294182-B2 | Method and device for separating a substance out of a solution | 20140319 |
Complexity: | 239 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 174.068079557 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 174.068079557 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 34.1 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS