2,2-Difluorocyclobutanamine Hydrochloride - CAS 1638761-45-1
Catalog: |
BB012052 |
Product Name: |
2,2-Difluorocyclobutanamine Hydrochloride |
CAS: |
1638761-45-1 |
Synonyms: |
2,2-difluoro-1-cyclobutanamine;hydrochloride; 2,2-difluorocyclobutan-1-amine;hydrochloride |
IUPAC Name: | 2,2-difluorocyclobutan-1-amine;hydrochloride |
Description: | 2,2-Difluorocyclobutanamine Hydrochloride (CAS# 1638761-45-1 ) is a useful research chemical. |
Molecular Weight: | 143.56 |
Molecular Formula: | C4H8ClF2N |
Canonical SMILES: | C1CC(C1N)(F)F.Cl |
InChI: | InChI=1S/C4H7F2N.ClH/c5-4(6)2-1-3(4)7;/h3H,1-2,7H2;1H |
InChI Key: | UKYPDSRUQXIUHD-UHFFFAOYSA-N |
GHS Hazard Statement: | H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021064077-A1 | Substituted pyrazolopyrimidines as irak4 inhibitors | 20191002 |
WO-2020036949-A1 | Ask1 inhibiting agents | 20180814 |
AU-2019321412-A1 | Ask1 inhibiting agents | 20180814 |
CN-113227070-A | ASK1 inhibitors | 20180814 |
EP-3837251-A1 | Ask1 inhibiting agents | 20180814 |
Complexity: | 81.8 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 2 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 143.0313333 |
Formal Charge: | 0 |
Heavy Atom Count: | 8 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 143.0313333 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 26 Å2 |
Undefined Atom Stereocenter Count: | 1 |
Undefined Bond Stereocenter Count: | 0 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS