2,2-Difluoro-2-(2-methoxyphenyl)acetic Acid - CAS 1250773-62-6
Catalog: |
BB006056 |
Product Name: |
2,2-Difluoro-2-(2-methoxyphenyl)acetic Acid |
CAS: |
1250773-62-6 |
Synonyms: |
2,2-difluoro-2-(2-methoxyphenyl)acetic acid; 2,2-difluoro-2-(2-methoxyphenyl)acetic acid |
IUPAC Name: | 2,2-difluoro-2-(2-methoxyphenyl)acetic acid |
Description: | 2,2-Difluoro-2-(2-methoxyphenyl)acetic Acid (CAS# 1250773-62-6) is a useful research chemical. |
Molecular Weight: | 202.15 |
Molecular Formula: | C9H8F2O3 |
Canonical SMILES: | COC1=CC=CC=C1C(C(=O)O)(F)F |
InChI: | InChI=1S/C9H8F2O3/c1-14-7-5-3-2-4-6(7)9(10,11)8(12)13/h2-5H,1H3,(H,12,13) |
InChI Key: | ULFXSWWASZBBPE-UHFFFAOYSA-N |
LogP: | 1.87160 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
US-2018371016-A1 | Trifluoromethylpropanamide derivatives as htra1 inhibitors | 20160304 |
US-11014963-B2 | Trifluoromethylpropanamide derivatives as HTRA1 inhibitors | 20160304 |
AU-2015287688-A1 | Antiproliferative compounds and methods of use thereof | 20140711 |
AU-2015287688-B2 | Antiproliferative compounds and methods of use thereof | 20140711 |
CA-2954784-A1 | Antiproliferative compounds and methods of use thereof | 20140711 |
Complexity: | 218 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 202.04415044 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 202.04415044 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 46.5 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS