2-(2-Chlorophenyl)-2-(1-pyrrolidinyl)ethylamine - CAS 791601-03-1
Catalog: |
BB036300 |
Product Name: |
2-(2-Chlorophenyl)-2-(1-pyrrolidinyl)ethylamine |
CAS: |
791601-03-1 |
Synonyms: |
2-(2-chlorophenyl)-2-(1-pyrrolidinyl)ethanamine; 2-(2-chlorophenyl)-2-pyrrolidin-1-ylethanamine |
IUPAC Name: | 2-(2-chlorophenyl)-2-pyrrolidin-1-ylethanamine |
Description: | 2-(2-Chlorophenyl)-2-(1-pyrrolidinyl)ethylamine (CAS# 791601-03-1) is a useful research chemical. |
Molecular Weight: | 224.73 |
Molecular Formula: | C12H17ClN2 |
Canonical SMILES: | C1CCN(C1)C(CN)C2=CC=CC=C2Cl |
InChI: | InChI=1S/C12H17ClN2/c13-11-6-2-1-5-10(11)12(9-14)15-7-3-4-8-15/h1-2,5-6,12H,3-4,7-9,14H2 |
InChI Key: | IZHQBEMKODNZFF-UHFFFAOYSA-N |
MDL: | MFCD01631943 |
LogP: | 3.07380 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P260, P264, P270, P280, P301+P312, P301+P330+P331, P303+P361+P353, P304+P340, P305+P351+P338, P310, P321, P330, P363, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
CA-2657601-A1 | Substituted indazoles | 20060714 |
EP-2044031-A1 | 2-(heteroaryl) alkyl indazole 6-phenyl and thienyl methyl amide as thrombin inhibitors | 20060714 |
JP-2009543818-A | Substituted indazoles | 20060714 |
US-2010105663-A1 | 2-(heteroaryl) alkyl indazole 6-phenyl and thienyl methyl amide as thrombin inhibitors | 20060714 |
WO-2008006479-A1 | 2-(heteroaryl) alkyl indazole 6-phenyl and thienyl methyl amide as thrombin inhibitors | 20060714 |
Complexity: | 192 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 224.1080262 |
Formal Charge: | 0 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 224.1080262 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 29.3 Å2 |
Undefined Atom Stereocenter Count: | 1 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS