2-(2-Chloro-4-methoxyphenyl)ethanamine - CAS 67932-57-4
Catalog: |
BB033440 |
Product Name: |
2-(2-Chloro-4-methoxyphenyl)ethanamine |
CAS: |
67932-57-4 |
Synonyms: |
2-(2-chloro-4-methoxyphenyl)ethanamine; 2-(2-chloro-4-methoxyphenyl)ethanamine |
IUPAC Name: | 2-(2-chloro-4-methoxyphenyl)ethanamine |
Description: | 2-(2-Chloro-4-methoxyphenyl)ethanamine (CAS# 67932-57-4 ) is a useful research chemical. |
Molecular Weight: | 185.65 |
Molecular Formula: | C9H12ClNO |
Canonical SMILES: | COC1=CC(=C(C=C1)CCN)Cl |
InChI: | InChI=1S/C9H12ClNO/c1-12-8-3-2-7(4-5-11)9(10)6-8/h2-3,6H,4-5,11H2,1H3 |
InChI Key: | SZQPCLQVRLLNHD-UHFFFAOYSA-N |
LogP: | 2.55010 |
Publication Number | Title | Priority Date |
EP-3483149-A1 | Benzo[d]thiazole derivative or salt thereof, and pharmaceutical composition including same | 20160708 |
JP-2019520403-A | Benzo [D] thiazole derivative or salt thereof, and pharmaceutical composition containing the same | 20160708 |
KR-20180006167-A | Benzo[d]thiazole derivative or its salt and pharmaceutical composition comprising the same | 20160708 |
US-10383859-B2 | Benzo[d]thiazole derivative or salt thereof, and pharmaceutical composition including same | 20160708 |
US-2019142809-A1 | Benzo[D]Thiazole Derivative Or Salt Thereof, And Pharmaceutical Composition Including Same | 20160708 |
Complexity: | 132 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 185.0607417 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 185.0607417 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 35.2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.8 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS