2-(2-Chloro-4-fluorophenyl)ethanamine - CAS 338739-59-6
Catalog: |
BB021876 |
Product Name: |
2-(2-Chloro-4-fluorophenyl)ethanamine |
CAS: |
338739-59-6 |
Synonyms: |
2-(2-chloro-4-fluorophenyl)ethanamine; 2-(2-chloro-4-fluorophenyl)ethanamine |
IUPAC Name: | 2-(2-chloro-4-fluorophenyl)ethanamine |
Description: | 2-(2-Chloro-4-fluorophenyl)ethanamine (CAS# 338739-59-6 ) is a useful research chemical. |
Molecular Weight: | 173.62 |
Molecular Formula: | C8H9ClFN |
Canonical SMILES: | C1=CC(=C(C=C1F)Cl)CCN |
InChI: | InChI=1S/C8H9ClFN/c9-8-5-7(10)2-1-6(8)3-4-11/h1-2,5H,3-4,11H2 |
InChI Key: | GQNIKIAATCRXFQ-UHFFFAOYSA-N |
LogP: | 2.68060 |
Publication Number | Title | Priority Date |
AU-2015362700-A1 | Indole and azaindoles derivatives and their use in neurodegenerative diseases | 20141215 |
AU-2015362700-B2 | Indole and azaindoles derivatives and their use in neurodegenerative diseases | 20141215 |
CA-2967694-A1 | Indole and azaindoles derivatives and their use in neurodegenerative diseases | 20141215 |
EP-3233841-A1 | Indole and azaindoles derivatives and their use in neurodegenerative diseases | 20141215 |
JP-2017537982-A | Indole and azaindole derivatives and their use in neurodegenerative diseases | 20141215 |
Complexity: | 121 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 173.0407551 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 173.0407551 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 26 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS