2,2,2-Trifluoro-4'-iodoacetophenone - CAS 23516-84-9
Catalog: |
BB018085 |
Product Name: |
2,2,2-Trifluoro-4'-iodoacetophenone |
CAS: |
23516-84-9 |
Synonyms: |
2,2,2-trifluoro-1-(4-iodophenyl)ethanone; 2,2,2-trifluoro-1-(4-iodophenyl)ethanone |
IUPAC Name: | 2,2,2-trifluoro-1-(4-iodophenyl)ethanone |
Description: | 2,2,2-Trifluoro-4'-iodoacetophenone (CAS# 23516-84-9) is a useful research chemical. |
Molecular Weight: | 300.02 |
Molecular Formula: | C8H4F3IO |
Canonical SMILES: | C1=CC(=CC=C1C(=O)C(F)(F)F)I |
InChI: | InChI=1S/C8H4F3IO/c9-8(10,11)7(13)5-1-3-6(12)4-2-5/h1-4H |
InChI Key: | GCWVQAKIKOQSGP-UHFFFAOYSA-N |
MDL: | MFCD02260838 |
LogP: | 3.03620 |
Publication Number | Title | Priority Date |
EP-2647617-A1 | Nucleoside analog or salt thereof, oligonucleotide analog, gene expression inhibitor, and nucleic-acid probe for detecting gene | 20101130 |
EP-2647617-B1 | Nucleoside analog or salt thereof, oligonucleotide analog, gene expression inhibitor, and nucleic-acid probe for detecting gene | 20101130 |
US-2014221637-A1 | Nucleoside analog or salt thereof, oligonucleotide analog, gene expression inhibitor, and nucleic-acid probe for detecting gene | 20101130 |
US-8865898-B2 | Nucleoside analog or salt thereof, oligonucleotide analog, gene expression inhibitor, and nucleic-acid probe for detecting gene | 20101130 |
WO-2012074012-A1 | Nucleoside analog or salt thereof, oligonucleotide analog, gene expression inhibitor, and nucleic-acid probe for detecting gene | 20101130 |
Complexity: | 194 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 299.9259 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 299.9259 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 17.1 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.8 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS