2,2,2,3',5'-Pentafluoroacetophenone - CAS 845823-12-3
Catalog: |
BB037245 |
Product Name: |
2,2,2,3',5'-Pentafluoroacetophenone |
CAS: |
845823-12-3 |
Synonyms: |
1-(3,5-difluorophenyl)-2,2,2-trifluoroethanone; 1-(3,5-difluorophenyl)-2,2,2-trifluoroethanone |
IUPAC Name: | 1-(3,5-difluorophenyl)-2,2,2-trifluoroethanone |
Description: | 2,2,2,3',5'-Pentafluoroacetophenone (CAS# 845823-12-3) is a useful research chemical. |
Molecular Weight: | 210.10 |
Molecular Formula: | C8H3F5O |
Canonical SMILES: | C1=C(C=C(C=C1F)F)C(=O)C(F)(F)F |
InChI: | InChI=1S/C8H3F5O/c9-5-1-4(2-6(10)3-5)7(14)8(11,12)13/h1-3H |
InChI Key: | VPJBBHOADBTNFQ-UHFFFAOYSA-N |
Boiling Point: | 173.4 ℃ at 760 mmHg |
Density: | 1.441 g/cm3 |
MDL: | MFCD01319993 |
LogP: | 2.70980 |
GHS Hazard Statement: | H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
AU-2017346516-A1 | Piperidine derivatives as inhibitors of ubiquitin specific protease 7 | 20161020 |
CN-110088096-A | The piperidine derivative of inhibitor as ubiquitin-specific protease 7 | 20161020 |
EP-3529241-A1 | Piperidine derivatives as inhibitors of ubiquitin specific protease 7 | 20161020 |
US-2019256518-A1 | Piperidine derivatives as inhibitors of ubiquitin specific protease 7 | 20161020 |
WO-2018073602-A1 | Piperidine derivatives as inhibitors of ubiquitin specific protease 7 | 20161020 |
Complexity: | 214 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 210.01040553 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 210.01040553 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 17.1 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS