1H-Pyrido[2,3-b][1,4]oxazin-2(3H)-one - CAS 136742-83-1
Catalog: |
BB008403 |
Product Name: |
1H-Pyrido[2,3-b][1,4]oxazin-2(3H)-one |
CAS: |
136742-83-1 |
Synonyms: |
1H-pyrido[2,3-b][1,4]oxazin-2-one |
IUPAC Name: | 1H-pyrido[2,3-b][1,4]oxazin-2-one |
Description: | 1H-Pyrido[2,3-b][1,4]oxazin-2(3H)-one (CAS# 136742-83-1) is a useful research chemical compound. |
Molecular Weight: | 150.13 |
Molecular Formula: | C7H6N2O2 |
Canonical SMILES: | C1C(=O)NC2=C(O1)N=CC=C2 |
InChI: | InChI=1S/C7H6N2O2/c10-6-4-11-7-5(9-6)2-1-3-8-7/h1-3H,4H2,(H,9,10) |
InChI Key: | ORNSLMJWQDGQFF-UHFFFAOYSA-N |
Purity: | 95 % |
MDL: | MFCD01549954 |
LogP: | 0.55050 |
Publication Number | Title | Priority Date |
WO-2020121261-A1 | 3,3-difluoroallylamines or salts thereof and pharmaceutical compositions comprising the same | 20181214 |
WO-2020121263-A1 | Triazolopyridin-3-ones or their salts and pharmaceutical compositions comprising the same | 20181214 |
US-2020223827-A1 | 3,3-difluoroallylamines or salts thereof and pharmaceutical compositions comprising the same | 20181214 |
US-2020223844-A1 | Triazolopyridin-3-ones or their salts and pharmaceutical compositions comprising the same | 20181214 |
TW-202039447-A | 3,3-difluoroallylamines or salts thereof and pharmaceutical compositions comprising the same | 20181214 |
Complexity: | 172 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 150.042927438 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 150.042927438 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 51.2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS