1-(Trifluoromethyl)cyclopentane-1-carboxylic acid - CAS 277756-44-2
Catalog: |
BB019667 |
Product Name: |
1-(Trifluoromethyl)cyclopentane-1-carboxylic acid |
CAS: |
277756-44-2 |
Synonyms: |
1-(trifluoromethyl)cyclopentane-1-carboxylic acid |
IUPAC Name: | 1-(trifluoromethyl)cyclopentane-1-carboxylic acid |
Description: | 1-(Trifluoromethyl)cyclopentane-1-carboxylic acid (CAS# 277756-44-2) is a useful research chemical. |
Molecular Weight: | 182.14 |
Molecular Formula: | C7H9F3O2 |
Canonical SMILES: | C1CCC(C1)(C(=O)O)C(F)(F)F |
InChI: | InChI=1S/C7H9F3O2/c8-7(9,10)6(5(11)12)3-1-2-4-6/h1-4H2,(H,11,12) |
InChI Key: | DGQRYPPBAJNZFZ-UHFFFAOYSA-N |
Boiling Point: | 205.5 ℃ at 760 mmHg |
Density: | 1.375 g/cm3 |
Appearance: | White crystalline powder |
MDL: | MFCD08445821 |
LogP: | 2.19370 |
GHS Hazard Statement: | H301 (90.91%): Toxic if swallowed [Danger Acute toxicity, oral] |
Precautionary Statement: | P264, P270, P301+P310, P321, P330, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
CN-111162313-A | Polymer electrolyte and lithium ion battery | 20191223 |
WO-2021066088-A1 | Novel triazine derivative | 20191002 |
WO-2020103859-A1 | RIP1 Inhibitors | 20181120 |
CN-113272272-A | RIP1 inhibitors | 20181120 |
EP-3883918-A1 | Rip1 inhibitors | 20181120 |
Complexity: | 191 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 182.05546401 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 182.05546401 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 37.3 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Cyclopentane
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS