(1-Pyridin-4-ylpropyl)amine - CAS 60289-68-1
Catalog: |
BB030636 |
Product Name: |
(1-Pyridin-4-ylpropyl)amine |
CAS: |
60289-68-1 |
Synonyms: |
1-pyridin-4-ylpropan-1-amine |
IUPAC Name: | 1-pyridin-4-ylpropan-1-amine |
Description: | (1-Pyridin-4-ylpropyl)amine (CAS# 60289-68-1) is a useful research chemical. |
Molecular Weight: | 136.19 |
Molecular Formula: | C8H12N2 |
Canonical SMILES: | CCC(C1=CC=NC=C1)N |
InChI: | InChI=1S/C8H12N2/c1-2-8(9)7-3-5-10-6-4-7/h3-6,8H,2,9H2,1H3 |
InChI Key: | VGFZORUFTNLGLI-UHFFFAOYSA-N |
Boiling Point: | 238.4 °C at 760 mmHg |
Density: | 0.998 g/cm3 |
LogP: | 2.19170 |
GHS Hazard Statement: | H314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation] |
Precautionary Statement: | P260, P264, P280, P301+P330+P331, P303+P361+P353, P304+P340, P305+P351+P338, P310, P321, P363, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
US-2020231547-A1 | 2-(1,1'-biphenyl)-1h-benzodimidazole derivatives and related compounds as apelin and apj agonists for treating cardiovascular diseases | 20170817 |
US-2019315711-A1 | Therapeutic compounds and compositions | 20161223 |
AU-2017371674-A1 | Benzenesulfonamide compounds and their use as therapeutic agents | 20161209 |
BR-112019011121-A2 | benzenesulfonamide compounds and their use as therapeutic agents | 20161209 |
CA-3042004-A1 | Benzenesulfonamide compounds and their use as therapeutic agents | 20161209 |
Complexity: | 87.3 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 136.100048391 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 136.100048391 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 38.9 Å2 |
Undefined Atom Stereocenter Count: | 1 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS