1-(p-tolyl)-1-cyclopentanecarboxylic acid - CAS 80789-75-9
Catalog: |
BB036552 |
Product Name: |
1-(p-tolyl)-1-cyclopentanecarboxylic acid |
CAS: |
80789-75-9 |
Synonyms: |
1-(4-methylphenyl)-1-cyclopentanecarboxylic acid; 1-(4-methylphenyl)cyclopentane-1-carboxylic acid |
IUPAC Name: | 1-(4-methylphenyl)cyclopentane-1-carboxylic acid |
Description: | 1-(p-tolyl)-1-cyclopentanecarboxylic acid (CAS# 80789-75-9 ) is a useful research chemical. |
Molecular Weight: | 204.26 |
Molecular Formula: | C13H16O2 |
Canonical SMILES: | CC1=CC=C(C=C1)C2(CCCC2)C(=O)O |
InChI: | InChI=1S/C13H16O2/c1-10-4-6-11(7-5-10)13(12(14)15)8-2-3-9-13/h4-7H,2-3,8-9H2,1H3,(H,14,15) |
InChI Key: | YKDWTRWSHHGVII-UHFFFAOYSA-N |
Boiling Point: | 355.7 °C at 760 mmHg |
Density: | 1.135 g/cm3 |
LogP: | 2.89140 |
Publication Number | Title | Priority Date |
CN-104144995-A | Silane group-containing polymer composition and coatings containing same | 20120125 |
CN-110655871-A | Polymer composition containing silane groups and coatings containing the same | 20120125 |
EP-2807223-A2 | Silane group-containing polymer composition and coatings containing same | 20120125 |
JP-2015506405-A | Silane group-containing polymer composition and coating containing the same | 20120125 |
JP-2018141157-A | Silane group-containing polymer composition and coating containing the same | 20120125 |
Complexity: | 233 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 204.115029749 |
Formal Charge: | 0 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 204.115029749 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 37.3 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS