1-methylpyrrolidine-3-carboxylic acid hydrochloride - CAS 50585-87-0
Catalog: |
BB027121 |
Product Name: |
1-methylpyrrolidine-3-carboxylic acid hydrochloride |
CAS: |
50585-87-0 |
Synonyms: |
1-methyl-3-pyrrolidinecarboxylic acid;hydrochloride; 1-methylpyrrolidine-3-carboxylic acid;hydrochloride |
IUPAC Name: | 1-methylpyrrolidine-3-carboxylic acid;hydrochloride |
Description: | 1-methylpyrrolidine-3-carboxylic acid hydrochloride (CAS# 50585-87-0) is a useful research chemical. |
Molecular Weight: | 165.617 |
Molecular Formula: | C6H12ClNO2 |
Canonical SMILES: | CN1CCC(C1)C(=O)O.Cl |
InChI: | InChI=1S/C6H11NO2.ClH/c1-7-3-2-5(4-7)6(8)9;/h5H,2-4H2,1H3,(H,8,9);1H |
InChI Key: | JFWLEGORBDKYIG-UHFFFAOYSA-N |
MDL: | MFCD06738921 |
LogP: | 0.76260 |
GHS Hazard Statement: | H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
TW-201943715-A | Bicyclic compound and use thereof for inhibiting histone methyltransferase | 20180413 |
TW-201927749-A | Cationic lipid | 20171227 |
WO-2019131580-A1 | Cationic lipid | 20171227 |
CA-3084657-A1 | Cationic lipid | 20171227 |
CN-111417621-A | Cationic lipids | 20171227 |
Complexity: | 124 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 2 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 165.0556563 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 165.0556563 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 40.5 Å2 |
Undefined Atom Stereocenter Count: | 1 |
Undefined Bond Stereocenter Count: | 0 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyrrolidines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS