1-Methylpyrido[2,3-d]pyrimidine-2,4(1H,3H)-dione - CAS 142168-85-2
Catalog: |
BB009317 |
Product Name: |
1-Methylpyrido[2,3-d]pyrimidine-2,4(1H,3H)-dione |
CAS: |
142168-85-2 |
Synonyms: |
1-methylpyrido[2,3-d]pyrimidine-2,4-dione; 1-methylpyrido[2,3-d]pyrimidine-2,4-dione |
IUPAC Name: | 1-methylpyrido[2,3-d]pyrimidine-2,4-dione |
Description: | 1-Methylpyrido[2,3-d]pyrimidine-2,4(1H,3H)-dione (CAS# 142168-85-2) is a useful research chemical for organic synthesis and other chemical processes. |
Molecular Weight: | 177.16 |
Molecular Formula: | C8H7N3O2 |
Canonical SMILES: | CN1C2=C(C=CC=N2)C(=O)NC1=O |
InChI: | InChI=1S/C8H7N3O2/c1-11-6-5(3-2-4-9-6)7(12)10-8(11)13/h2-4H,1H3,(H,10,12,13) |
InChI Key: | RHJWPKURFUYZTM-UHFFFAOYSA-N |
LogP: | 0.03410 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CN-107614501-B | Hydroxyl purine compound and application thereof | 20150520 |
EP-3299371-A1 | Hydroxyl purine compounds and use thereof | 20150520 |
JP-2018515559-A | Hydroxypurine compounds and applications thereof | 20150520 |
JP-6511692-B2 | Hydroxypurine compound and its application | 20150520 |
TW-201706268-A | Hydroxyl purine compound and application thereof | 20150520 |
Complexity: | 254 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 177.053826475 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 177.053826475 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 62.3 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | -0.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS