1-Methylcyclopropanemethanol - CAS 2746-14-7
Catalog: |
BB019572 |
Product Name: |
1-Methylcyclopropanemethanol |
CAS: |
2746-14-7 |
Synonyms: |
(1-methylcyclopropyl)methanol |
IUPAC Name: | (1-methylcyclopropyl)methanol |
Description: | 1-Methylcyclopropanemethanol (CAS# 2746-14-7) is a useful research chemical. |
Molecular Weight: | 86.13 |
Molecular Formula: | C5H10O |
Canonical SMILES: | CC1(CC1)CO |
InChI: | InChI=1S/C5H10O/c1-5(4-6)2-3-5/h6H,2-4H2,1H3 |
InChI Key: | PIZQWRXTMGASCZ-UHFFFAOYSA-N |
MDL: | MFCD00009682 |
LogP: | 0.77880 |
GHS Hazard Statement: | H226 (100%): Flammable liquid and vapor [Warning Flammable liquids] |
Precautionary Statement: | P210, P233, P240, P241, P242, P243, P280, P303+P361+P353, P370+P378, P403+P235, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
JP-2021138690-A | Pharmaceuticals consisting of novel heteroaromatic amide derivatives or salts thereof | 20200228 |
US-2021292348-A1 | Antiviral compounds | 20200218 |
WO-2021167882-A1 | Antiviral compounds | 20200218 |
WO-2021168004-A1 | Antiviral compounds | 20200218 |
WO-2021139775-A1 | Pyridone compound and application | 20200110 |
Complexity: | 55 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 86.073164938 |
Formal Charge: | 0 |
Heavy Atom Count: | 6 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 86.073164938 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 20.2 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Alcohols and Derivatives
Oxygen Compounds
Customers Also Viewed
-
[57166-92-4]
Methylenediamine dihydrochloride
-
[132182-92-4]
Pentane, 1,1,1,2,2,3,4,5,5,5-decafluoro-3-methoxy-4-(trifluoromethyl)-
-
[172531-37-2]
Azido-PEG3-acetic acid
-
[104517-96-6]
Ioversol related compound B
-
[1866059-82-6]
1,1,2,2-Tetrafluoro-3-methylsulfonylpropane
-
[94086-78-9]
Isopropyl 4-[4-[N,N-bis(2-hydroxyethyl)amino]phenyl]butyrate
INDUSTRY LEADERS TRUST OUR PRODUCTS