1-Methyl-4-imidazolemethanol - CAS 17289-25-7
Catalog: |
BB012869 |
Product Name: |
1-Methyl-4-imidazolemethanol |
CAS: |
17289-25-7 |
Synonyms: |
(1-methyl-4-imidazolyl)methanol; (1-methylimidazol-4-yl)methanol |
IUPAC Name: | (1-methylimidazol-4-yl)methanol |
Description: | 1-Methyl-4-imidazolemethanol (CAS# 17289-25-7) is a useful research chemical. |
Molecular Weight: | 112.13 |
Molecular Formula: | C5H8N2O |
Canonical SMILES: | CN1C=C(N=C1)CO |
InChI: | InChI=1S/C5H8N2O/c1-7-2-5(3-8)6-4-7/h2,4,8H,3H2,1H3 |
InChI Key: | NLEAEGDBKRBJAP-UHFFFAOYSA-N |
Boiling Point: | 324.9 ℃ at 760 mmHg |
Density: | 1.16 g/cm3 |
Appearance: | Solid |
MDL: | MFCD06738905 |
LogP: | -0.08760 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P322, P330, P332+P313, P337+P313, P362, P363, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021041671-A1 | Kras g12d inhibitors | 20190829 |
WO-2020035031-A1 | Fused ring compounds | 20180816 |
AU-2019320945-A1 | Fused ring compounds | 20180816 |
EP-3746436-A1 | Fused ring compounds | 20180816 |
KR-20200115549-A | Fused ring compound | 20180816 |
Complexity: | 76.8 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 112.063662883 |
Formal Charge: | 0 |
Heavy Atom Count: | 8 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 112.063662883 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 38 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | -0.8 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Alcohols and Derivatives
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS