1-Methyl 2-iodoterephthalate - CAS 299173-24-3
Catalog: |
BB020382 |
Product Name: |
1-Methyl 2-iodoterephthalate |
CAS: |
299173-24-3 |
Synonyms: |
3-iodo-4-methoxycarbonylbenzoic acid |
IUPAC Name: | 3-iodo-4-methoxycarbonylbenzoic acid |
Description: | 1-Methyl 2-iodoterephthalate (CAS# 299173-24-3) is a useful research chemical compound. |
Molecular Weight: | 306.05 |
Molecular Formula: | C9H7IO4 |
Canonical SMILES: | COC(=O)C1=C(C=C(C=C1)C(=O)O)I |
InChI: | InChI=1S/C9H7IO4/c1-14-9(13)6-3-2-5(8(11)12)4-7(6)10/h2-4H,1H3,(H,11,12) |
InChI Key: | AGYGRJJIWDNTLI-UHFFFAOYSA-N |
Boiling Point: | 391.1 °C at 760 mmHg |
Density: | 1.89 g/cm3 |
MDL: | MFCD06798132 |
LogP: | 1.77600 |
GHS Hazard Statement: | H301 (100%): Toxic if swallowed [Danger Acute toxicity, oral] |
Precautionary Statement: | P264, P270, P301+P316, P321, P330, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
AU-2017277422-A1 | Anti-EGFR antibody drug conjugates | 20160608 |
AU-2017277517-A1 | Anti-EGFR antibody drug conjugates | 20160608 |
AU-2017277914-A1 | Anti-CD98 antibodies and antibody drug conjugates | 20160608 |
AU-2017277920-A1 | Anti-CD98 antibodies and antibody drug conjugates | 20160608 |
AU-2017279539-A1 | Anti-B7-H3 antibodies and antibody drug conjugates | 20160608 |
Complexity: | 241 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 305.93891 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 305.93891 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 63.6 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS