1-Methyl-1H-indole-3-carbonitrile - CAS 24662-37-1
Catalog: |
BB018573 |
Product Name: |
1-Methyl-1H-indole-3-carbonitrile |
CAS: |
24662-37-1 |
Synonyms: |
1-methylindole-3-carbonitrile |
IUPAC Name: | 1-methylindole-3-carbonitrile |
Description: | 1-Methyl-1H-indole-3-carbonitrile (CAS# 24662-37-1) is a useful research chemical. |
Molecular Weight: | 156.18 |
Molecular Formula: | C10H8N2 |
Canonical SMILES: | CN1C=C(C2=CC=CC=C21)C#N |
InChI: | InChI=1S/C10H8N2/c1-12-7-8(6-11)9-4-2-3-5-10(9)12/h2-5,7H,1H3 |
InChI Key: | FBAXZPMXGBNBPE-UHFFFAOYSA-N |
Boiling Point: | 327.8 ℃ at 760 mmHg |
Density: | 1.09 g/cm3 |
MDL: | MFCD00466602 |
LogP: | 2.04998 |
Publication Number | Title | Priority Date |
EP-3732210-A1 | Composition including multiple terminally functionalized polymers | 20171230 |
US-2020369791-A1 | Composition Including Multiple Terminally Functionalized Polymers | 20171230 |
US-2020369620-A1 | Chiral 1,3-diarylimidazolium salt carbene precursor, synthesis method therefor, metal salt compound and application thereof | 20171115 |
EP-3608363-A1 | Rubber composition, method for producing rubber composition, and tire | 20170407 |
US-2020190293-A1 | Rubber composition, method for manufacturing rubber composition, and tire | 20170407 |
PMID | Publication Date | Title | Journal |
16483769 | 20060501 | Low molecular weight indole fragments as IMPDH inhibitors | Bioorganic & medicinal chemistry letters |
16483773 | 20060501 | Novel indole inhibitors of IMPDH from fragments: synthesis and initial structure-activity relationships | Bioorganic & medicinal chemistry letters |
Complexity: | 215 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 156.068748264 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 156.068748264 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 28.7 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Indoles
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS