1-Methyl-1H-1,2,4-triazole-3-carbaldehyde - CAS 126748-87-6
Catalog: |
BB006655 |
Product Name: |
1-Methyl-1H-1,2,4-triazole-3-carbaldehyde |
CAS: |
126748-87-6 |
Synonyms: |
1-methyl-1,2,4-triazole-3-carboxaldehyde; 1-methyl-1,2,4-triazole-3-carbaldehyde |
IUPAC Name: | 1-methyl-1,2,4-triazole-3-carbaldehyde |
Description: | 1-Methyl-1H-1,2,4-triazole-3-carbaldehyde (CAS# 126748-87-6 ) is a useful research chemical. |
Molecular Weight: | 111.10 |
Molecular Formula: | C4H5N3O |
Canonical SMILES: | CN1C=NC(=N1)C=O |
InChI: | InChI=1S/C4H5N3O/c1-7-3-5-4(2-8)6-7/h2-3H,1H3 |
InChI Key: | NLBSACQGJDXXNQ-UHFFFAOYSA-N |
LogP: | 0.00000 |
GHS Hazard Statement: | H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
BR-112019017058-A2 | compounds such as pde1 inhibitors, pharmaceutical composition and use thereof | 20171220 |
BR-112019017171-A2 | 1h-pyrazolo [4,3-b] pde1-inhibiting pyridines, pharmaceutical composition and use thereof | 20171220 |
TW-201927779-A | 1H-pyrazolo[4,3-b]pyridine as a PDE1 inhibitor | 20171220 |
TW-201927784-A | As a major ring of PDE1 inhibitors | 20171220 |
US-10618913-B2 | Macrocycles as PDE1 inhibitors | 20171220 |
Complexity: | 95.3 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 111.043261792 |
Formal Charge: | 0 |
Heavy Atom Count: | 8 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 111.043261792 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 47.8 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | -0.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS