1-Methyl-1,10-phenanthrolin-2(1H)-one - CAS 31535-89-4
Catalog: |
BB020966 |
Product Name: |
1-Methyl-1,10-phenanthrolin-2(1H)-one |
CAS: |
31535-89-4 |
Synonyms: |
1-methyl-1,10-phenanthrolin-2-one; 1-methyl-1,10-phenanthrolin-2-one |
IUPAC Name: | 1-methyl-1,10-phenanthrolin-2-one |
Description: | 1-Methyl-1,10-phenanthrolin-2(1H)-one (CAS# 31535-89-4 ) is a useful research chemical. |
Molecular Weight: | 210.23 |
Molecular Formula: | C13H10N2O |
Canonical SMILES: | CN1C(=O)C=CC2=C1C3=C(C=CC=N3)C=C2 |
InChI: | InChI=1S/C13H10N2O/c1-15-11(16)7-6-10-5-4-9-3-2-8-14-12(9)13(10)15/h2-8H,1H3 |
InChI Key: | IXAWJXFNSQYESB-UHFFFAOYSA-N |
LogP: | 2.08670 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P264, P270, P280, P301+P312, P305+P351+P338, P330, P337+P313, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
EP-2683725-A1 | Rare earth metal complex having phenanthroline compound as ligand | 20110311 |
EP-2683725-B1 | Rare earth metal complex having phenanthroline compound as ligand | 20110311 |
JP-2014509585-A | Rare earth metal complexes with phenanthroline compounds as ligands | 20110311 |
US-2014058073-A1 | Rare earth metal complex having phenanthroline compound as ligand | 20110311 |
US-9187690-B2 | Rare earth metal complex having phenanthroline compound as ligand | 20110311 |
Complexity: | 326 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 210.079312947 |
Formal Charge: | 0 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 210.079312947 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 33.2 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.8 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS