1-Iodo-3,5-dimethylbenzene - CAS 22445-41-6
Catalog: |
BB017627 |
Product Name: |
1-Iodo-3,5-dimethylbenzene |
CAS: |
22445-41-6 |
Synonyms: |
1-iodo-3,5-dimethylbenzene |
IUPAC Name: | 1-iodo-3,5-dimethylbenzene |
Description: | 1-Iodo-3,5-dimethylbenzene (CAS# 22445-41-6) is a useful research chemical. |
Molecular Weight: | 232.06 |
Molecular Formula: | C8H9I |
Canonical SMILES: | CC1=CC(=CC(=C1)I)C |
InChI: | InChI=1S/C8H9I/c1-6-3-7(2)5-8(9)4-6/h3-5H,1-2H3 |
InChI Key: | ZLMKEENUYIUKKC-UHFFFAOYSA-N |
Boiling Point: | 92-94 ℃ (3 mmHg) |
Purity: | 95 % |
Density: | 1.608 g/cm3 |
Appearance: | Clear light yellow liquid |
MDL: | MFCD00060659 |
LogP: | 2.90800 |
GHS Hazard Statement: | H315 (97.92%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021123294-A1 | Oga inhibitor compounds | 20191218 |
WO-2021125319-A1 | Liquid crystal aligning agent, radical generation film and method for producing in-plane switching liquid crystal cell | 20191218 |
WO-2021125329-A1 | Radical generation film-forming composition, radical generation film, and method for manufacturing horizontal-electric-field liquid crystal cell | 20191218 |
WO-2021095878-A1 | Method for producing fluoropolyether group-containing compound | 20191113 |
WO-2021054570-A1 | Hardmask composition, hardmask layer, and pattern forming method | 20190917 |
PMID | Publication Date | Title | Journal |
21404338 | 20110418 | Photoinduced nitric oxide release from a nitrobenzene derivative in mitochondria | Chemistry (Weinheim an der Bergstrasse, Germany) |
Complexity: | 80.6 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 231.97490 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 0 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 231.97490 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 0 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Halides
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS