1-Ethynyl-4-phenoxybenzene - CAS 4200-06-0
Catalog: |
BB025007 |
Product Name: |
1-Ethynyl-4-phenoxybenzene |
CAS: |
4200-06-0 |
Synonyms: |
1-ethynyl-4-phenoxybenzene |
IUPAC Name: | 1-ethynyl-4-phenoxybenzene |
Description: | 1-Ethynyl-4-phenoxybenzene can be used for Sonogashira coupling reactions. |
Molecular Weight: | 194.23 |
Molecular Formula: | C14H10O |
Canonical SMILES: | C#CC1=CC=C(C=C1)OC2=CC=CC=C2 |
InChI: | InChI=1S/C14H10O/c1-2-12-8-10-14(11-9-12)15-13-6-4-3-5-7-13/h1,3-11H |
InChI Key: | LKMNQDOAPYPSNH-UHFFFAOYSA-N |
Boiling Point: | 285.1 ℃ at 760 mmHg |
Purity: | 98 % |
Density: | 1.074 g/cm3 |
Appearance: | Colorless to yellow liquid |
MDL: | MFCD03839992 |
LogP: | 3.46020 |
GHS Hazard Statement: | H317 (100%): May cause an allergic skin reaction [Warning Sensitization, Skin] |
Precautionary Statement: | P261, P272, P273, P280, P302+P352, P305+P351+P338, P310, P321, P333+P313, P363, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
WO-2020223672-A1 | Functionalized cyclic polymers and methods of preparing same | 20190501 |
WO-2020102892-A1 | 3'-unsaturated abscisic acid derivatives as aba antagonists | 20181119 |
EP-3883915-A1 | 3'-unsaturated abscisic acid derivatives as aba antagonists | 20181119 |
KR-20200021788-A | Polymer, organic layer composition and method of forming patterns | 20180821 |
TW-202009245-A | Polymer, organic layer composition and method of forming patterns | 20180821 |
Complexity: | 223 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 194.073164938 |
Formal Charge: | 0 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 194.073164938 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 9.2 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Alkynes
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS